C21H32N4O4 — CID 90294650
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-cyclobutyl-4-methylpentanamide (PubChem CID 90294650) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-cyclobutyl-4-methylpentanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-cyclobutyl-4-methylpentanamide |
|---|---|
| PubChem CID | 90294650 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-cyclobutyl-4-methylpentanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CC(C)C)C(=O)NC2CCC2)cc1OC |
| InChI | InChI=1S/C21H32N4O4/c1-13(2)10-16(20(27)23-15-6-5-7-15)24-21(22)25-19(26)12-14-8-9-17(28-3)18(11-14)29-4/h8-9,11,13,15-16H,5-7,10,12H2,1-4H3,(H,23,27)(H3,22,24,25,26)/t16-/m1/s1 |
| InChIKey | DSJRROXVRHWOAH-MRXNPFEDSA-N |
| XLogP | 1.76 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|