C26H34N4O6 — CID 90294447
methyl 4-[[[(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoyl]amino]methyl]benzoate (PubChem CID 90294447) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is methyl 4-[[[(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 90294447 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | methyl 4-[[[(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)[C@@H](CC(C)C)/N=C(\N)NC(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H34N4O6/c1-16(2)12-20(24(32)28-15-17-6-9-19(10-7-17)25(33)36-5)29-26(27)30-23(31)14-18-8-11-21(34-3)22(13-18)35-4/h6-11,13,16,20H,12,14-15H2,1-5H3,(H,28,32)(H3,27,29,30,31)/t20-/m1/s1 |
| InChIKey | JYRPISNJZQQDDE-HXUWFJFHSA-N |
| XLogP | 2.19 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|