C30H36N4O6 — CID 118586509
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenylpropanamide (PubChem CID 118586509) has the molecular formula C30H36N4O6 and a molecular weight of 548.64 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenylpropanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 118586509 |
| Molecular Formula | C30H36N4O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenylpropanamide |
| SMILES | COc1ccc(CCNC(=O)C(Cc2ccccc2)/N=C(\N)NC(=O)Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C30H36N4O6/c1-37-24-12-10-21(17-26(24)39-3)14-15-32-29(36)23(16-20-8-6-5-7-9-20)33-30(31)34-28(35)19-22-11-13-25(38-2)27(18-22)40-4/h5-13,17-18,23H,14-16,19H2,1-4H3,(H,32,36)(H3,31,33,34,35) |
| InChIKey | YKEZBLANTQXUNH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|