C26H26BrFN4O3 — CID 90285920
(2R)-2-[[amino-[[2-(2-bromophenyl)acetyl]amino]methylidene]amino]-N-[(4-fluoro-3-methoxyphenyl)methyl]-3-phenylpropanamide (PubChem CID 90285920) has the molecular formula C26H26BrFN4O3 and a molecular weight of 541.42 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(2-bromophenyl)acetyl]amino]methylidene]amino]-N-[(4-fluoro-3-methoxyphenyl)methyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(2-bromophenyl)acetyl]amino]methylidene]amino]-N-[(4-fluoro-3-methoxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 90285920 |
| Molecular Formula | C26H26BrFN4O3 |
| Molecular Weight | 541.42 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (2R)-2-[[amino-[[2-(2-bromophenyl)acetyl]amino]methylidene]amino]-N-[(4-fluoro-3-methoxyphenyl)methyl]-3-phenylpropanamide |
| SMILES | COc1cc(CNC(=O)[C@@H](Cc2ccccc2)/N=C(\N)NC(=O)Cc2ccccc2Br)ccc1F |
| InChI | InChI=1S/C26H26BrFN4O3/c1-35-23-14-18(11-12-21(23)28)16-30-25(34)22(13-17-7-3-2-4-8-17)31-26(29)32-24(33)15-19-9-5-6-10-20(19)27/h2-12,14,22H,13,15-16H2,1H3,(H,30,34)(H3,29,31,32,33)/t22-/m1/s1 |
| InChIKey | ZCJUSFOMVFMAMP-JOCHJYFZSA-N |
| XLogP | 3.50 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|