C29H30N6O4S — CID 123984961
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[[4-(thiadiazol-4-yl)phenyl]methyl]propanamide (PubChem CID 123984961) has the molecular formula C29H30N6O4S and a molecular weight of 558.66 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[[4-(thiadiazol-4-yl)phenyl]methyl]propanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[[4-(thiadiazol-4-yl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 123984961 |
| Molecular Formula | C29H30N6O4S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[[4-(thiadiazol-4-yl)phenyl]methyl]propanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(Cc2ccccc2)C(=O)NCc2ccc(-c3csnn3)cc2)cc1OC |
| InChI | InChI=1S/C29H30N6O4S/c1-38-25-13-10-21(15-26(25)39-2)16-27(36)33-29(30)32-23(14-19-6-4-3-5-7-19)28(37)31-17-20-8-11-22(12-9-20)24-18-40-35-34-24/h3-13,15,18,23H,14,16-17H2,1-2H3,(H,31,37)(H3,30,32,33,36) |
| InChIKey | RWHWYSWKACSDPB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 140.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|