C27H38N4O6 — CID 175066174
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylhexanamide (PubChem CID 175066174) has the molecular formula C27H38N4O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylhexanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylhexanamide |
|---|---|
| PubChem CID | 175066174 |
| Molecular Formula | C27H38N4O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylhexanamide |
| SMILES | CCC(C)CC(/N=C(\N)NC(=O)Cc1ccc(OC)c(OC)c1)C(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H38N4O6/c1-7-17(2)12-20(26(33)29-16-19-9-11-22(35-4)24(14-19)37-6)30-27(28)31-25(32)15-18-8-10-21(34-3)23(13-18)36-5/h8-11,13-14,17,20H,7,12,15-16H2,1-6H3,(H,29,33)(H3,28,30,31,32) |
| InChIKey | IRAWFKLDYPZQNA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|