C26H37FN4O6 — CID 90285499
2-(3,4-dimethoxyphenyl)-N-[N'-[(2R,3R)-3-methylpentan-2-yl]carbamimidoyl]acetamide;(4-fluoro-3-methoxyphenyl)methylcarbamic acid (PubChem CID 90285499) has the molecular formula C26H37FN4O6 and a molecular weight of 520.60 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[N'-[(2R,3R)-3-methylpentan-2-yl]carbamimidoyl]acetamide;(4-fluoro-3-methoxyphenyl)methylcarbamic acid.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[N'-[(2R,3R)-3-methylpentan-2-yl]carbamimidoyl]acetamide;(4-fluoro-3-methoxyphenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 90285499 |
| Molecular Formula | C26H37FN4O6 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[N'-[(2R,3R)-3-methylpentan-2-yl]carbamimidoyl]acetamide;(4-fluoro-3-methoxyphenyl)methylcarbamic acid |
| SMILES | CC[C@@H](C)[C@@H](C)/N=C(\N)NC(=O)Cc1ccc(OC)c(OC)c1.COc1cc(CNC(=O)O)ccc1F |
| InChI | InChI=1S/C17H27N3O3.C9H10FNO3/c1-6-11(2)12(3)19-17(18)20-16(21)10-13-7-8-14(22-4)15(9-13)23-5;1-14-8-4-6(2-3-7(8)10)5-11-9(12)13/h7-9,11-12H,6,10H2,1-5H3,(H3,18,19,20,21);2-4,11H,5H2,1H3,(H,12,13)/t11-,12-;/m1./s1 |
| InChIKey | UYGYCPVPYKEMCV-MNMPKAIFSA-N |
| XLogP | 3.71 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|