C18H27N3O5 — CID 175058709
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylhexanoic acid (PubChem CID 175058709) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylhexanoic acid.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 175058709 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylhexanoic acid |
| SMILES | CCC(C)CC(/N=C(\N)NC(=O)Cc1ccc(OC)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C18H27N3O5/c1-5-11(2)8-13(17(23)24)20-18(19)21-16(22)10-12-6-7-14(25-3)15(9-12)26-4/h6-7,9,11,13H,5,8,10H2,1-4H3,(H,23,24)(H3,19,20,21,22) |
| InChIKey | QWTQNMTYIREIEU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|