C22H34N4O4 — CID 175058706
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclopropylmethyl)-4-methylhexanamide (PubChem CID 175058706) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclopropylmethyl)-4-methylhexanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclopropylmethyl)-4-methylhexanamide |
|---|---|
| PubChem CID | 175058706 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclopropylmethyl)-4-methylhexanamide |
| SMILES | CCC(C)CC(/N=C(\N)NC(=O)Cc1ccc(OC)c(OC)c1)C(=O)NCC1CC1 |
| InChI | InChI=1S/C22H34N4O4/c1-5-14(2)10-17(21(28)24-13-15-6-7-15)25-22(23)26-20(27)12-16-8-9-18(29-3)19(11-16)30-4/h8-9,11,14-15,17H,5-7,10,12-13H2,1-4H3,(H,24,28)(H3,23,25,26,27) |
| InChIKey | KTCVTXXHOBNWAR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|