C26H34N4O4 — CID 118583242
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-4-methylpentanamide (PubChem CID 118583242) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-4-methylpentanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 118583242 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-4-methylpentanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CC(C)C)C(=O)N[C@@H]2CCc3ccccc32)cc1OC |
| InChI | InChI=1S/C26H34N4O4/c1-16(2)13-21(25(32)28-20-11-10-18-7-5-6-8-19(18)20)29-26(27)30-24(31)15-17-9-12-22(33-3)23(14-17)34-4/h5-9,12,14,16,20-21H,10-11,13,15H2,1-4H3,(H,28,32)(H3,27,29,30,31)/t20-,21-/m1/s1 |
| InChIKey | GKEFJJAVYAFHKO-NHCUHLMSSA-N |
| XLogP | 2.90 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|