C27H36N4O5 — CID 123890136
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(4-methoxy-2,3-dihydro-1H-inden-2-yl)-4-methylpentanamide (PubChem CID 123890136) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(4-methoxy-2,3-dihydro-1H-inden-2-yl)-4-methylpentanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(4-methoxy-2,3-dihydro-1H-inden-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 123890136 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(4-methoxy-2,3-dihydro-1H-inden-2-yl)-4-methylpentanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(CC(C)C)C(=O)NC2Cc3cccc(OC)c3C2)cc1OC |
| InChI | InChI=1S/C27H36N4O5/c1-16(2)11-21(26(33)29-19-14-18-7-6-8-22(34-3)20(18)15-19)30-27(28)31-25(32)13-17-9-10-23(35-4)24(12-17)36-5/h6-10,12,16,19,21H,11,13-15H2,1-5H3,(H,29,33)(H3,28,30,31,32) |
| InChIKey | PXAIATUMMJKJCY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|