C25H34N4O4 — CID 90294427
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methylbutyl)-3-phenylpropanamide (PubChem CID 90294427) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methylbutyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methylbutyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 90294427 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methylbutyl)-3-phenylpropanamide |
| SMILES | CCC(C)CNC(=O)[C@@H](Cc1ccccc1)/N=C(\N)NC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H34N4O4/c1-5-17(2)16-27-24(31)20(13-18-9-7-6-8-10-18)28-25(26)29-23(30)15-19-11-12-21(32-3)22(14-19)33-4/h6-12,14,17,20H,5,13,15-16H2,1-4H3,(H,27,31)(H3,26,28,29,30)/t17?,20-/m1/s1 |
| InChIKey | NORCLGIIIHAFDO-UUSAFJCLSA-N |
| XLogP | 2.45 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|