C30H35BrN4O6 — CID 175066565
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide (PubChem CID 175066565) has the molecular formula C30H35BrN4O6 and a molecular weight of 627.54 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 175066565 |
| Molecular Formula | C30H35BrN4O6 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(Cc2ccccc2)C(=O)NCCc2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C30H35BrN4O6/c1-38-24-11-10-20(15-25(24)39-2)16-28(36)35-30(32)34-23(14-19-8-6-5-7-9-19)29(37)33-13-12-21-17-26(40-3)27(41-4)18-22(21)31/h5-11,15,17-18,23H,12-14,16H2,1-4H3,(H,33,37)(H3,32,34,35,36) |
| InChIKey | QNGNHBGLBVCKQT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|