C31H33N5O7 — CID 123180244
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 123180244) has the molecular formula C31H33N5O7 and a molecular weight of 587.63 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 123180244 |
| Molecular Formula | C31H33N5O7 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CC(/N=C(\N)NC(=O)Cc2ccc(OC)c(OC)c2)C(=O)NCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C31H33N5O7/c1-41-21-11-8-19(9-12-21)16-24(28(38)33-14-15-36-29(39)22-6-4-5-7-23(22)30(36)40)34-31(32)35-27(37)18-20-10-13-25(42-2)26(17-20)43-3/h4-13,17,24H,14-16,18H2,1-3H3,(H,33,38)(H3,32,34,35,37) |
| InChIKey | KHWJYCWZRLBLQK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|