C31H40N4O4 — CID 90285332
(2R)-2-[[[[2-(1-adamantyl)acetyl]amino]-aminomethylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide (PubChem CID 90285332) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is (2R)-2-[[[[2-(1-adamantyl)acetyl]amino]-aminomethylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[[[2-(1-adamantyl)acetyl]amino]-aminomethylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 90285332 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | (2R)-2-[[[[2-(1-adamantyl)acetyl]amino]-aminomethylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
| SMILES | COc1ccc(CNC(=O)[C@@H](Cc2ccccc2)/N=C(\N)NC(=O)CC23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C31H40N4O4/c1-38-26-9-8-21(14-27(26)39-2)19-33-29(37)25(13-20-6-4-3-5-7-20)34-30(32)35-28(36)18-31-15-22-10-23(16-31)12-24(11-22)17-31/h3-9,14,22-25H,10-13,15-19H2,1-2H3,(H,33,37)(H3,32,34,35,36)/t22?,23?,24?,25-,31?/m1/s1 |
| InChIKey | RYELIVWAMTYYJC-BLVCCSLHSA-N |
| XLogP | 3.97 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|