C30H38ClN5O5 — CID 90285199
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-3-cyclohexylpropanamide (PubChem CID 90285199) has the molecular formula C30H38ClN5O5 and a molecular weight of 584.12 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-3-cyclohexylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 90285199 |
| Molecular Formula | C30H38ClN5O5 |
| Molecular Weight | 584.12 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-3-cyclohexylpropanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CC2CCCCC2)C(=O)N[C@H]2CCN(c3cccc(Cl)c3)C2=O)cc1OC |
| InChI | InChI=1S/C30H38ClN5O5/c1-40-25-12-11-20(16-26(25)41-2)17-27(37)35-30(32)34-24(15-19-7-4-3-5-8-19)28(38)33-23-13-14-36(29(23)39)22-10-6-9-21(31)18-22/h6,9-12,16,18-19,23-24H,3-5,7-8,13-15,17H2,1-2H3,(H,33,38)(H3,32,34,35,37)/t23-,24+/m0/s1 |
| InChIKey | NGYQLNSCMPSOKY-BJKOFHAPSA-N |
| XLogP | 3.59 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.12 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|