C24H40N4O2 — CID 144669551
3-cyclohexyl-N-(2-methylbutyl)propanamide;N-(diaminomethylidene)-3-phenylpropanamide (PubChem CID 144669551) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is 3-cyclohexyl-N-(2-methylbutyl)propanamide;N-(diaminomethylidene)-3-phenylpropanamide.
| Compound Name | 3-cyclohexyl-N-(2-methylbutyl)propanamide;N-(diaminomethylidene)-3-phenylpropanamide |
|---|---|
| PubChem CID | 144669551 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | 3-cyclohexyl-N-(2-methylbutyl)propanamide;N-(diaminomethylidene)-3-phenylpropanamide |
| SMILES | CCC(C)CNC(=O)CCC1CCCCC1.NC(N)=NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H27NO.C10H13N3O/c1-3-12(2)11-15-14(16)10-9-13-7-5-4-6-8-13;11-10(12)13-9(14)7-6-8-4-2-1-3-5-8/h12-13H,3-11H2,1-2H3,(H,15,16);1-5H,6-7H2,(H4,11,12,13,14) |
| InChIKey | IZTIIFQPEFGOHV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|