C28H37F5N4O3 — CID 144669622
3-cyclohexylpropanal;N-(diaminomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide;1-(4-fluoro-3-methoxyphenyl)-N-methylmethanamine (PubChem CID 144669622) has the molecular formula C28H37F5N4O3 and a molecular weight of 572.62 g/mol. Its IUPAC name is 3-cyclohexylpropanal;N-(diaminomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide;1-(4-fluoro-3-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 3-cyclohexylpropanal;N-(diaminomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide;1-(4-fluoro-3-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 144669622 |
| Molecular Formula | C28H37F5N4O3 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 3-cyclohexylpropanal;N-(diaminomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide;1-(4-fluoro-3-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNCc1ccc(F)c(OC)c1.NC(N)=NC(=O)Cc1ccc(F)c(C(F)(F)F)c1.O=CCCC1CCCCC1 |
| InChI | InChI=1S/C10H9F4N3O.C9H12FNO.C9H16O/c11-7-2-1-5(3-6(7)10(12,13)14)4-8(18)17-9(15)16;1-11-6-7-3-4-8(10)9(5-7)12-2;10-8-4-7-9-5-2-1-3-6-9/h1-3H,4H2,(H4,15,16,17,18);3-5,11H,6H2,1-2H3;8-9H,1-7H2 |
| InChIKey | JQXQWIVYQVXBFG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|