C27H31BrF4N4O3 — CID 90286040
(2R)-2-[[2-[2-bromo-4-(trifluoromethyl)phenyl]acetyl]-carbamimidoylamino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide (PubChem CID 90286040) has the molecular formula C27H31BrF4N4O3 and a molecular weight of 615.47 g/mol. Its IUPAC name is (2R)-2-[[2-[2-bromo-4-(trifluoromethyl)phenyl]acetyl]-carbamimidoylamino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide.
| Compound Name | (2R)-2-[[2-[2-bromo-4-(trifluoromethyl)phenyl]acetyl]-carbamimidoylamino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 90286040 |
| Molecular Formula | C27H31BrF4N4O3 |
| Molecular Weight | 615.47 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | (2R)-2-[[2-[2-bromo-4-(trifluoromethyl)phenyl]acetyl]-carbamimidoylamino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
| SMILES | [H]/N=C(\N)N(C(=O)Cc1ccc(C(F)(F)F)cc1Br)[C@H](CC1CCCCC1)C(=O)NCc1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C27H31BrF4N4O3/c1-39-23-12-17(7-10-21(23)29)15-35-25(38)22(11-16-5-3-2-4-6-16)36(26(33)34)24(37)13-18-8-9-19(14-20(18)28)27(30,31)32/h7-10,12,14,16,22H,2-6,11,13,15H2,1H3,(H3,33,34)(H,35,38)/t22-/m1/s1 |
| InChIKey | XBVAXDGMGDSOEL-JOCHJYFZSA-N |
| XLogP | 5.54 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|