C18H25F3N2O3 — CID 54429996
(3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]butanamide (PubChem CID 54429996) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 54429996 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]butanamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)C(O)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-26-15-8-7-12(18(19,20)21)10-14(15)23-17(25)16(24)13(22)9-11-5-3-2-4-6-11/h7-8,10-11,13,16,24H,2-6,9,22H2,1H3,(H,23,25)/t13-,16?/m1/s1 |
| InChIKey | WGUOUKCWOHTCDH-JBZHPUCOSA-N |
| XLogP | 3.31 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |