C27H26F3NO3 — CID 42544780
(2S)-2-cyclopentyl-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-2-phenylacetamide (PubChem CID 42544780) has the molecular formula C27H26F3NO3 and a molecular weight of 469.50 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-2-phenylacetamide.
| Compound Name | (2S)-2-cyclopentyl-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 42544780 |
| Molecular Formula | C27H26F3NO3 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (2S)-2-cyclopentyl-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-2-phenylacetamide |
| SMILES | COc1ccccc1Oc1ccc(C(F)(F)F)cc1NC(=O)[C@H](c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C27H26F3NO3/c1-33-23-13-7-8-14-24(23)34-22-16-15-20(27(28,29)30)17-21(22)31-26(32)25(19-11-5-6-12-19)18-9-3-2-4-10-18/h2-4,7-10,13-17,19,25H,5-6,11-12H2,1H3,(H,31,32)/t25-/m1/s1 |
| InChIKey | PUQMYJJCGJVJIG-RUZDIDTESA-N |
| XLogP | 7.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |