C19H21NO — CID 2794045
2-cyclopentyl-N,2-diphenylacetamide (PubChem CID 2794045) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-cyclopentyl-N,2-diphenylacetamide.
| Compound Name | 2-cyclopentyl-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 2794045 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-cyclopentyl-N,2-diphenylacetamide |
| SMILES | O=C(Nc1ccccc1)C(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H21NO/c21-19(20-17-13-5-2-6-14-17)18(16-11-7-8-12-16)15-9-3-1-4-10-15/h1-6,9-10,13-14,16,18H,7-8,11-12H2,(H,20,21) |
| InChIKey | QCDPHZJTCRGRKL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |