C32H31NO — CID 40909844
(2R)-2-cyclopentyl-2-phenyl-N-[(R)-phenyl-(4-phenylphenyl)methyl]acetamide (PubChem CID 40909844) has the molecular formula C32H31NO and a molecular weight of 445.61 g/mol. Its IUPAC name is (2R)-2-cyclopentyl-2-phenyl-N-[(R)-phenyl-(4-phenylphenyl)methyl]acetamide.
| Compound Name | (2R)-2-cyclopentyl-2-phenyl-N-[(R)-phenyl-(4-phenylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 40909844 |
| Molecular Formula | C32H31NO |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | (2R)-2-cyclopentyl-2-phenyl-N-[(R)-phenyl-(4-phenylphenyl)methyl]acetamide |
| SMILES | O=C(N[C@H](c1ccccc1)c1ccc(-c2ccccc2)cc1)[C@@H](c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C32H31NO/c34-32(30(27-16-10-11-17-27)26-14-6-2-7-15-26)33-31(28-18-8-3-9-19-28)29-22-20-25(21-23-29)24-12-4-1-5-13-24/h1-9,12-15,18-23,27,30-31H,10-11,16-17H2,(H,33,34)/t30-,31+/m0/s1 |
| InChIKey | YXXGIIIVUXNKIL-IOWSJCHKSA-N |
| XLogP | 7.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |