C33H32N2O — CID 11420067
(2R)-N-benzhydryl-2-(benzhydrylideneamino)-2-cyclopentylacetamide (PubChem CID 11420067) has the molecular formula C33H32N2O and a molecular weight of 472.63 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-(benzhydrylideneamino)-2-cyclopentylacetamide.
| Compound Name | (2R)-N-benzhydryl-2-(benzhydrylideneamino)-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 11420067 |
| Molecular Formula | C33H32N2O |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | (2R)-N-benzhydryl-2-(benzhydrylideneamino)-2-cyclopentylacetamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)[C@H](N=C(c1ccccc1)c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C33H32N2O/c36-33(35-31(27-19-9-3-10-20-27)28-21-11-4-12-22-28)32(29-23-13-14-24-29)34-30(25-15-5-1-6-16-25)26-17-7-2-8-18-26/h1-12,15-22,29,31-32H,13-14,23-24H2,(H,35,36)/t32-/m1/s1 |
| InChIKey | RHBSTYHAGNHXSE-JGCGQSQUSA-N |
| XLogP | 6.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|