C23H29NO2 — CID 139837992
methyl 3-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzoate (PubChem CID 139837992) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl 3-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzoate.
| Compound Name | methyl 3-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzoate |
|---|---|
| PubChem CID | 139837992 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | methyl 3-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzoate |
| SMILES | COC(=O)c1cccc(C(N[C@H](C)C2CCCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H29NO2/c1-17(18-10-5-3-6-11-18)24-22(19-12-7-4-8-13-19)20-14-9-15-21(16-20)23(25)26-2/h4,7-9,12-18,22,24H,3,5-6,10-11H2,1-2H3/t17-,22?/m1/s1 |
| InChIKey | RGUZHQPAEZPEFC-PLEWWHCXSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |