C22H30N2O — CID 70189187
3-[[[(1R)-1-cyclohexylethyl]amino]-(4-methoxyphenyl)methyl]aniline (PubChem CID 70189187) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 3-[[[(1R)-1-cyclohexylethyl]amino]-(4-methoxyphenyl)methyl]aniline.
| Compound Name | 3-[[[(1R)-1-cyclohexylethyl]amino]-(4-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 70189187 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 3-[[[(1R)-1-cyclohexylethyl]amino]-(4-methoxyphenyl)methyl]aniline |
| SMILES | COc1ccc(C(N[C@H](C)C2CCCCC2)c2cccc(N)c2)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-16(17-7-4-3-5-8-17)24-22(19-9-6-10-20(23)15-19)18-11-13-21(25-2)14-12-18/h6,9-17,22,24H,3-5,7-8,23H2,1-2H3/t16-,22?/m1/s1 |
| InChIKey | JFQJGOMELCLDNG-XESZBRCGSA-N |
| XLogP | 4.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|