C22H26N2 — CID 139791611
4-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzonitrile (PubChem CID 139791611) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzonitrile.
| Compound Name | 4-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzonitrile |
|---|---|
| PubChem CID | 139791611 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-[[[(1R)-1-cyclohexylethyl]amino]-phenylmethyl]benzonitrile |
| SMILES | C[C@@H](NC(c1ccccc1)c1ccc(C#N)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H26N2/c1-17(19-8-4-2-5-9-19)24-22(20-10-6-3-7-11-20)21-14-12-18(16-23)13-15-21/h3,6-7,10-15,17,19,22,24H,2,4-5,8-9H2,1H3/t17-,22?/m1/s1 |
| InChIKey | RKNJVRATBRPBOJ-PLEWWHCXSA-N |
| XLogP | 5.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |