About methyl 3-cyclohexylbenzoate
methyl 3-cyclohexylbenzoate (PubChem CID 67160762) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is methyl 3-cyclohexylbenzoate.
Molecular Properties
| Compound Name | methyl 3-cyclohexylbenzoate |
| PubChem CID | 67160762 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | methyl 3-cyclohexylbenzoate |
| SMILES | COC(=O)c1cccc(C2CCCCC2)c1 |
| InChI | InChI=1S/C14H18O2/c1-16-14(15)13-9-5-8-12(10-13)11-6-3-2-4-7-11/h5,8-11H,2-4,6-7H2,1H3 |
| InChIKey | ZMWNTHMLRZLMJD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 3-cyclohexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-cyclohexylbenzoate?
The IUPAC name of methyl 3-cyclohexylbenzoate (CID 67160762) is methyl 3-cyclohexylbenzoate.
What is the SMILES notation for methyl 3-cyclohexylbenzoate?
The canonical SMILES for methyl 3-cyclohexylbenzoate is COC(=O)c1cccc(C2CCCCC2)c1.
What is the InChIKey of methyl 3-cyclohexylbenzoate?
The InChIKey is ZMWNTHMLRZLMJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-16-14(15)13-9-5-8-12(10-13)11-6-3-2-4-7-11/h5,8-11H,2-4,6-7H2,1H3.
What are the key properties of methyl 3-cyclohexylbenzoate?
methyl 3-cyclohexylbenzoate has a molecular weight of 218.30 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyclohexylbenzoate is sourced from PubChem (CID 67160762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).