About 1,3-dicyclohexylbenzene;hydrogen peroxide
1,3-dicyclohexylbenzene;hydrogen peroxide (PubChem CID 88772360) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is 1,3-dicyclohexylbenzene;hydrogen peroxide.
Molecular Properties
| Compound Name | 1,3-dicyclohexylbenzene;hydrogen peroxide |
| PubChem CID | 88772360 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1,3-dicyclohexylbenzene;hydrogen peroxide |
| SMILES | OO.OO.c1cc(C2CCCCC2)cc(C2CCCCC2)c1 |
| InChI | InChI=1S/C18H26.2H2O2/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;2*1-2/h7,12-16H,1-6,8-11H2;2*1-2H |
| InChIKey | KGWLWDWCAPHWDF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dicyclohexylbenzene;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexylbenzene;hydrogen peroxide?
The IUPAC name of 1,3-dicyclohexylbenzene;hydrogen peroxide (CID 88772360) is 1,3-dicyclohexylbenzene;hydrogen peroxide.
What is the SMILES notation for 1,3-dicyclohexylbenzene;hydrogen peroxide?
The canonical SMILES for 1,3-dicyclohexylbenzene;hydrogen peroxide is OO.OO.c1cc(C2CCCCC2)cc(C2CCCCC2)c1.
What is the InChIKey of 1,3-dicyclohexylbenzene;hydrogen peroxide?
The InChIKey is KGWLWDWCAPHWDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26.2H2O2/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;2*1-2/h7,12-16H,1-6,8-11H2;2*1-2H.
What are the key properties of 1,3-dicyclohexylbenzene;hydrogen peroxide?
1,3-dicyclohexylbenzene;hydrogen peroxide has a molecular weight of 310.43 g/mol, XLogP of 5.82, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexylbenzene;hydrogen peroxide is sourced from PubChem (CID 88772360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).