About 3-cycloheptylaniline
3-cycloheptylaniline (PubChem CID 22019641) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-cycloheptylaniline.
Molecular Properties
| Compound Name | 3-cycloheptylaniline |
| PubChem CID | 22019641 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-cycloheptylaniline |
| SMILES | Nc1cccc(C2CCCCCC2)c1 |
| InChI | InChI=1S/C13H19N/c14-13-9-5-8-12(10-13)11-6-3-1-2-4-7-11/h5,8-11H,1-4,6-7,14H2 |
| InChIKey | CCOQNNVHFYHBQJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-cycloheptylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cycloheptylaniline?
The IUPAC name of 3-cycloheptylaniline (CID 22019641) is 3-cycloheptylaniline.
What is the SMILES notation for 3-cycloheptylaniline?
The canonical SMILES for 3-cycloheptylaniline is Nc1cccc(C2CCCCCC2)c1.
What is the InChIKey of 3-cycloheptylaniline?
The InChIKey is CCOQNNVHFYHBQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c14-13-9-5-8-12(10-13)11-6-3-1-2-4-7-11/h5,8-11H,1-4,6-7,14H2.
What are the key properties of 3-cycloheptylaniline?
3-cycloheptylaniline has a molecular weight of 189.30 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cycloheptylaniline is sourced from PubChem (CID 22019641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).