About 3-cyclohexylphenol
3-cyclohexylphenol (PubChem CID 16036) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-cyclohexylphenol.
Molecular Properties
| Compound Name | 3-cyclohexylphenol |
| PubChem CID | 16036 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-cyclohexylphenol |
| SMILES | Oc1cccc(C2CCCCC2)c1 |
| InChI | InChI=1S/C12H16O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h4,7-10,13H,1-3,5-6H2 |
| InChIKey | WFKNYMUYMWAGCV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylphenol?
The IUPAC name of 3-cyclohexylphenol (CID 16036) is 3-cyclohexylphenol.
What is the SMILES notation for 3-cyclohexylphenol?
The canonical SMILES for 3-cyclohexylphenol is Oc1cccc(C2CCCCC2)c1.
What is the InChIKey of 3-cyclohexylphenol?
The InChIKey is WFKNYMUYMWAGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h4,7-10,13H,1-3,5-6H2.
What are the key properties of 3-cyclohexylphenol?
3-cyclohexylphenol has a molecular weight of 176.26 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylphenol is sourced from PubChem (CID 16036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).