C13H19NO — CID 115024223
3-(4-aminocycloheptyl)phenol (PubChem CID 115024223) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-(4-aminocycloheptyl)phenol.
| Compound Name | 3-(4-aminocycloheptyl)phenol |
|---|---|
| PubChem CID | 115024223 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-(4-aminocycloheptyl)phenol |
| SMILES | NC1CCCC(c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C13H19NO/c14-12-5-1-3-10(7-8-12)11-4-2-6-13(15)9-11/h2,4,6,9-10,12,15H,1,3,5,7-8,14H2 |
| InChIKey | XVYJBSSQXUMPCC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |