C12H16ClN — CID 95376050
cis-(1S,3R)-3-(3-chlorophenyl)cyclohexan-1-amine (PubChem CID 95376050) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is cis-(1S,3R)-3-(3-chlorophenyl)cyclohexan-1-amine.
| Compound Name | cis-(1S,3R)-3-(3-chlorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 95376050 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | cis-(1S,3R)-3-(3-chlorophenyl)cyclohexan-1-amine |
| SMILES | N[C@H]1CCC[C@@H](c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C12H16ClN/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1,3,5,7,10,12H,2,4,6,8,14H2/t10-,12+/m1/s1 |
| InChIKey | PQUXWNIBHDPXRE-PWSUYJOCSA-N |
| XLogP | 3.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |