C12H15F2N — CID 115027304
3-(4,4-difluorocyclohexyl)aniline (PubChem CID 115027304) has the molecular formula C12H15F2N and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(4,4-difluorocyclohexyl)aniline.
| Compound Name | 3-(4,4-difluorocyclohexyl)aniline |
|---|---|
| PubChem CID | 115027304 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-(4,4-difluorocyclohexyl)aniline |
| SMILES | Nc1cccc(C2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C12H15F2N/c13-12(14)6-4-9(5-7-12)10-2-1-3-11(15)8-10/h1-3,8-9H,4-7,15H2 |
| InChIKey | XGIRDQPJCHFHKG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|