About 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine
4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine (PubChem CID 117431735) has the molecular formula C19H29N
and a molecular weight of 271.45 g/mol. Its IUPAC name is 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine.
Molecular Properties
| Compound Name | 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine |
| PubChem CID | 117431735 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine |
| SMILES | CC1(C)CCC(c2cccc(C3CCNCC3)c2)CC1 |
| InChI | InChI=1S/C19H29N/c1-19(2)10-6-15(7-11-19)17-4-3-5-18(14-17)16-8-12-20-13-9-16/h3-5,14-16,20H,6-13H2,1-2H3 |
| InChIKey | JYCAIKCLKGPNES-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine?
The IUPAC name of 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine (CID 117431735) is 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine.
What is the SMILES notation for 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine?
The canonical SMILES for 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine is CC1(C)CCC(c2cccc(C3CCNCC3)c2)CC1.
What is the InChIKey of 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine?
The InChIKey is JYCAIKCLKGPNES-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N/c1-19(2)10-6-15(7-11-19)17-4-3-5-18(14-17)16-8-12-20-13-9-16/h3-5,14-16,20H,6-13H2,1-2H3.
What are the key properties of 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine?
4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine has a molecular weight of 271.45 g/mol, XLogP of 4.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4,4-dimethylcyclohexyl)phenyl]piperidine is sourced from PubChem (CID 117431735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).