C15H21N — CID 79979954
3-(3-cyclopropylphenyl)-2,2-dimethylpyrrolidine (PubChem CID 79979954) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-(3-cyclopropylphenyl)-2,2-dimethylpyrrolidine.
| Compound Name | 3-(3-cyclopropylphenyl)-2,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 79979954 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-(3-cyclopropylphenyl)-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)NCCC1c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C15H21N/c1-15(2)14(8-9-16-15)13-5-3-4-12(10-13)11-6-7-11/h3-5,10-11,14,16H,6-9H2,1-2H3 |
| InChIKey | AEOIDBCXJSSOPS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |