About methanamine;4-phenylpiperidine
methanamine;4-phenylpiperidine (PubChem CID 143444696) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is methanamine;4-phenylpiperidine.
Molecular Properties
| Compound Name | methanamine;4-phenylpiperidine |
| PubChem CID | 143444696 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | methanamine;4-phenylpiperidine |
| SMILES | CN.c1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C11H15N.CH5N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2/h1-5,11-12H,6-9H2;2H2,1H3 |
| InChIKey | KUCUWQHHLOEWHD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;4-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;4-phenylpiperidine?
The IUPAC name of methanamine;4-phenylpiperidine (CID 143444696) is methanamine;4-phenylpiperidine.
What is the SMILES notation for methanamine;4-phenylpiperidine?
The canonical SMILES for methanamine;4-phenylpiperidine is CN.c1ccc(C2CCNCC2)cc1.
What is the InChIKey of methanamine;4-phenylpiperidine?
The InChIKey is KUCUWQHHLOEWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.CH5N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2/h1-5,11-12H,6-9H2;2H2,1H3.
What are the key properties of methanamine;4-phenylpiperidine?
methanamine;4-phenylpiperidine has a molecular weight of 192.31 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;4-phenylpiperidine is sourced from PubChem (CID 143444696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).