About 4-phenylazocane
4-phenylazocane (PubChem CID 19847318) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 4-phenylazocane.
Molecular Properties
| Compound Name | 4-phenylazocane |
| PubChem CID | 19847318 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4-phenylazocane |
| SMILES | c1ccc(C2CCCCNCC2)cc1 |
| InChI | InChI=1S/C13H19N/c1-2-6-12(7-3-1)13-8-4-5-10-14-11-9-13/h1-3,6-7,13-14H,4-5,8-11H2 |
| InChIKey | GODXQIYIOSXEQG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylazocane?
The IUPAC name of 4-phenylazocane (CID 19847318) is 4-phenylazocane.
What is the SMILES notation for 4-phenylazocane?
The canonical SMILES for 4-phenylazocane is c1ccc(C2CCCCNCC2)cc1.
What is the InChIKey of 4-phenylazocane?
The InChIKey is GODXQIYIOSXEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-2-6-12(7-3-1)13-8-4-5-10-14-11-9-13/h1-3,6-7,13-14H,4-5,8-11H2.
What are the key properties of 4-phenylazocane?
4-phenylazocane has a molecular weight of 189.30 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylazocane is sourced from PubChem (CID 19847318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).