About cyclohexylbenzene;hydrogen peroxide;hydrate
cyclohexylbenzene;hydrogen peroxide;hydrate (PubChem CID 174910153) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is cyclohexylbenzene;hydrogen peroxide;hydrate.
Molecular Properties
| Compound Name | cyclohexylbenzene;hydrogen peroxide;hydrate |
| PubChem CID | 174910153 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | cyclohexylbenzene;hydrogen peroxide;hydrate |
| SMILES | O.OO.OO.c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16.2H2O2.H2O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2;/h1,3-4,7-8,12H,2,5-6,9-10H2;2*1-2H;1H2 |
| InChIKey | NIDQPFGJOVYDSD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylbenzene;hydrogen peroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylbenzene;hydrogen peroxide;hydrate?
The IUPAC name of cyclohexylbenzene;hydrogen peroxide;hydrate (CID 174910153) is cyclohexylbenzene;hydrogen peroxide;hydrate.
What is the SMILES notation for cyclohexylbenzene;hydrogen peroxide;hydrate?
The canonical SMILES for cyclohexylbenzene;hydrogen peroxide;hydrate is O.OO.OO.c1ccc(C2CCCCC2)cc1.
What is the InChIKey of cyclohexylbenzene;hydrogen peroxide;hydrate?
The InChIKey is NIDQPFGJOVYDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.2H2O2.H2O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2;/h1,3-4,7-8,12H,2,5-6,9-10H2;2*1-2H;1H2.
What are the key properties of cyclohexylbenzene;hydrogen peroxide;hydrate?
cyclohexylbenzene;hydrogen peroxide;hydrate has a molecular weight of 246.30 g/mol, XLogP of 2.94, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylbenzene;hydrogen peroxide;hydrate is sourced from PubChem (CID 174910153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).