About tert-butylbenzene;cyclohexylbenzene
tert-butylbenzene;cyclohexylbenzene (PubChem CID 158089404) has the molecular formula C22H30
and a molecular weight of 294.48 g/mol. Its IUPAC name is tert-butylbenzene;cyclohexylbenzene.
Molecular Properties
| Compound Name | tert-butylbenzene;cyclohexylbenzene |
| PubChem CID | 158089404 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | tert-butylbenzene;cyclohexylbenzene |
| SMILES | CC(C)(C)c1ccccc1.c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16.C10H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-10(2,3)9-7-5-4-6-8-9/h1,3-4,7-8,12H,2,5-6,9-10H2;4-8H,1-3H3 |
| InChIKey | FNXJQUGWSKFPAJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tert-butylbenzene;cyclohexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;cyclohexylbenzene?
The IUPAC name of tert-butylbenzene;cyclohexylbenzene (CID 158089404) is tert-butylbenzene;cyclohexylbenzene.
What is the SMILES notation for tert-butylbenzene;cyclohexylbenzene?
The canonical SMILES for tert-butylbenzene;cyclohexylbenzene is CC(C)(C)c1ccccc1.c1ccc(C2CCCCC2)cc1.
What is the InChIKey of tert-butylbenzene;cyclohexylbenzene?
The InChIKey is FNXJQUGWSKFPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C10H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-10(2,3)9-7-5-4-6-8-9/h1,3-4,7-8,12H,2,5-6,9-10H2;4-8H,1-3H3.
What are the key properties of tert-butylbenzene;cyclohexylbenzene?
tert-butylbenzene;cyclohexylbenzene has a molecular weight of 294.48 g/mol, XLogP of 6.72, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;cyclohexylbenzene is sourced from PubChem (CID 158089404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).