About tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane
tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane (PubChem CID 174813455) has the molecular formula C17H29NS
and a molecular weight of 279.49 g/mol. Its IUPAC name is tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane |
| PubChem CID | 174813455 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane |
| SMILES | C1CCC2SC2C1.CC(C)(C)c1ccccc1.CN |
| InChI | InChI=1S/C10H14.C6H10S.CH5N/c1-10(2,3)9-7-5-4-6-8-9;1-2-4-6-5(3-1)7-6;1-2/h4-8H,1-3H3;5-6H,1-4H2;2H2,1H3 |
| InChIKey | FUAPQMPFAVVIKX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane?
The IUPAC name of tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane (CID 174813455) is tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane.
What is the SMILES notation for tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane?
The canonical SMILES for tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane is C1CCC2SC2C1.CC(C)(C)c1ccccc1.CN.
What is the InChIKey of tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane?
The InChIKey is FUAPQMPFAVVIKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C6H10S.CH5N/c1-10(2,3)9-7-5-4-6-8-9;1-2-4-6-5(3-1)7-6;1-2/h4-8H,1-3H3;5-6H,1-4H2;2H2,1H3.
What are the key properties of tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane?
tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane has a molecular weight of 279.49 g/mol, XLogP of 4.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;methanamine;7-thiabicyclo[4.1.0]heptane is sourced from PubChem (CID 174813455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).