About (1R)-1-cyclopentyl-1-phenylethanol;sulfane
(1R)-1-cyclopentyl-1-phenylethanol;sulfane (PubChem CID 158992083) has the molecular formula C13H22OS2
and a molecular weight of 258.45 g/mol. Its IUPAC name is (1R)-1-cyclopentyl-1-phenylethanol;sulfane.
Molecular Properties
| Compound Name | (1R)-1-cyclopentyl-1-phenylethanol;sulfane |
| PubChem CID | 158992083 |
| Molecular Formula | C13H22OS2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (1R)-1-cyclopentyl-1-phenylethanol;sulfane |
| SMILES | C[C@](O)(c1ccccc1)C1CCCC1.S.S |
| InChI | InChI=1S/C13H18O.2H2S/c1-13(14,12-9-5-6-10-12)11-7-3-2-4-8-11;;/h2-4,7-8,12,14H,5-6,9-10H2,1H3;2*1H2/t13-;;/m0../s1 |
| InChIKey | JQHAYBYKWUABOJ-GXKRWWSZSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-cyclopentyl-1-phenylethanol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyclopentyl-1-phenylethanol;sulfane?
The IUPAC name of (1R)-1-cyclopentyl-1-phenylethanol;sulfane (CID 158992083) is (1R)-1-cyclopentyl-1-phenylethanol;sulfane.
What is the SMILES notation for (1R)-1-cyclopentyl-1-phenylethanol;sulfane?
The canonical SMILES for (1R)-1-cyclopentyl-1-phenylethanol;sulfane is C[C@](O)(c1ccccc1)C1CCCC1.S.S.
What is the InChIKey of (1R)-1-cyclopentyl-1-phenylethanol;sulfane?
The InChIKey is JQHAYBYKWUABOJ-GXKRWWSZSA-N. The full InChI is InChI=1S/C13H18O.2H2S/c1-13(14,12-9-5-6-10-12)11-7-3-2-4-8-11;;/h2-4,7-8,12,14H,5-6,9-10H2,1H3;2*1H2/t13-;;/m0../s1.
What are the key properties of (1R)-1-cyclopentyl-1-phenylethanol;sulfane?
(1R)-1-cyclopentyl-1-phenylethanol;sulfane has a molecular weight of 258.45 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyclopentyl-1-phenylethanol;sulfane is sourced from PubChem (CID 158992083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).