About 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol
2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol (PubChem CID 4068699) has the molecular formula C23H30O
and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol.
Molecular Properties
| Compound Name | 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol |
| PubChem CID | 4068699 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol |
| SMILES | CCC(C)(C1CCCCC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O/c1-3-22(2,19-13-7-4-8-14-19)23(24,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h5-6,9-12,15-19,24H,3-4,7-8,13-14H2,1-2H3 |
| InChIKey | IDSWJLYOJWDYGQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol?
The IUPAC name of 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol (CID 4068699) is 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol.
What is the SMILES notation for 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol?
The canonical SMILES for 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol is CCC(C)(C1CCCCC1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol?
The InChIKey is IDSWJLYOJWDYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O/c1-3-22(2,19-13-7-4-8-14-19)23(24,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h5-6,9-12,15-19,24H,3-4,7-8,13-14H2,1-2H3.
What are the key properties of 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol?
2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol has a molecular weight of 322.49 g/mol, XLogP of 5.92, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-methyl-1,1-diphenylbutan-1-ol is sourced from PubChem (CID 4068699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).