About 1-phenylcyclohexan-1-ol
1-phenylcyclohexan-1-ol (PubChem CID 15319) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-phenylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-phenylcyclohexan-1-ol |
| PubChem CID | 15319 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-phenylcyclohexan-1-ol |
| SMILES | OC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C12H16O/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h1,3-4,7-8,13H,2,5-6,9-10H2 |
| InChIKey | DTTDXHDYTWQDCS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylcyclohexan-1-ol?
The IUPAC name of 1-phenylcyclohexan-1-ol (CID 15319) is 1-phenylcyclohexan-1-ol.
What is the SMILES notation for 1-phenylcyclohexan-1-ol?
The canonical SMILES for 1-phenylcyclohexan-1-ol is OC1(c2ccccc2)CCCCC1.
What is the InChIKey of 1-phenylcyclohexan-1-ol?
The InChIKey is DTTDXHDYTWQDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h1,3-4,7-8,13H,2,5-6,9-10H2.
What are the key properties of 1-phenylcyclohexan-1-ol?
1-phenylcyclohexan-1-ol has a molecular weight of 176.26 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylcyclohexan-1-ol is sourced from PubChem (CID 15319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).