C17H30O2 — CID 142373793
(1R)-1-cyclopentyl-1-phenylethane-1,2-diol;ethane (PubChem CID 142373793) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (1R)-1-cyclopentyl-1-phenylethane-1,2-diol;ethane.
| Compound Name | (1R)-1-cyclopentyl-1-phenylethane-1,2-diol;ethane |
|---|---|
| PubChem CID | 142373793 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (1R)-1-cyclopentyl-1-phenylethane-1,2-diol;ethane |
| SMILES | CC.CC.OC[C@](O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C13H18O2.2C2H6/c14-10-13(15,12-8-4-5-9-12)11-6-2-1-3-7-11;2*1-2/h1-3,6-7,12,14-15H,4-5,8-10H2;2*1-2H3/t13-;;/m0../s1 |
| InChIKey | HASMAKUMRCFZQP-GXKRWWSZSA-N |
| XLogP | 4.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |