C21H31ClNO- — CID 53350693
1-cyclohexyl-5-(diethylamino)-1-phenylpent-3-yn-1-ol chloride (PubChem CID 53350693) has the molecular formula C21H31ClNO- and a molecular weight of 348.94 g/mol. Its IUPAC name is 1-cyclohexyl-5-(diethylamino)-1-phenylpent-3-yn-1-ol chloride.
| Compound Name | 1-cyclohexyl-5-(diethylamino)-1-phenylpent-3-yn-1-ol chloride |
|---|---|
| PubChem CID | 53350693 |
| Molecular Formula | C21H31ClNO- |
| Molecular Weight | 348.94 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-cyclohexyl-5-(diethylamino)-1-phenylpent-3-yn-1-ol chloride |
| SMILES | CCN(CC)CC#CCC(O)(c1ccccc1)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C21H31NO.ClH/c1-3-22(4-2)18-12-11-17-21(23,19-13-7-5-8-14-19)20-15-9-6-10-16-20;/h5,7-8,13-14,20,23H,3-4,6,9-10,15-18H2,1-2H3;1H/p-1 |
| InChIKey | DIGHORHXEDLFEY-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.94 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|