C21H32NO+ — CID 4223063
(5-cyclopentyl-5-hydroxy-5-phenylpent-2-ynyl)-ethyl-propan-2-ylazanium (PubChem CID 4223063) has the molecular formula C21H32NO+ and a molecular weight of 314.49 g/mol. Its IUPAC name is (5-cyclopentyl-5-hydroxy-5-phenylpent-2-ynyl)-ethyl-propan-2-ylazanium.
| Compound Name | (5-cyclopentyl-5-hydroxy-5-phenylpent-2-ynyl)-ethyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 4223063 |
| Molecular Formula | C21H32NO+ |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (5-cyclopentyl-5-hydroxy-5-phenylpent-2-ynyl)-ethyl-propan-2-ylazanium |
| SMILES | CC[NH+](CC#CCC(O)(c1ccccc1)C1CCCC1)C(C)C |
| InChI | InChI=1S/C21H31NO/c1-4-22(18(2)3)17-11-10-16-21(23,20-14-8-9-15-20)19-12-6-5-7-13-19/h5-7,12-13,18,20,23H,4,8-9,14-17H2,1-3H3/p+1 |
| InChIKey | DLDCQRZDSQREOW-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|