C21H31ClN2O — CID 5309456
1-cyclopentyl-5-(4-methylpiperazin-1-yl)-1-phenylpent-3-yn-1-ol;hydrochloride (PubChem CID 5309456) has the molecular formula C21H31ClN2O and a molecular weight of 362.95 g/mol. Its IUPAC name is 1-cyclopentyl-5-(4-methylpiperazin-1-yl)-1-phenylpent-3-yn-1-ol;hydrochloride.
| Compound Name | 1-cyclopentyl-5-(4-methylpiperazin-1-yl)-1-phenylpent-3-yn-1-ol;hydrochloride |
|---|---|
| PubChem CID | 5309456 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-cyclopentyl-5-(4-methylpiperazin-1-yl)-1-phenylpent-3-yn-1-ol;hydrochloride |
| SMILES | CN1CCN(CC#CCC(O)(c2ccccc2)C2CCCC2)CC1.Cl |
| InChI | InChI=1S/C21H30N2O.ClH/c1-22-15-17-23(18-16-22)14-8-7-13-21(24,20-11-5-6-12-20)19-9-3-2-4-10-19;/h2-4,9-10,20,24H,5-6,11-18H2,1H3;1H |
| InChIKey | UTNARMLTDJECBD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|