C23H32N2O2 — CID 15023468
2-cyclohexyl-2-hydroxy-2-phenyl-N-(4-piperidin-1-ylbut-2-ynyl)acetamide (PubChem CID 15023468) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-cyclohexyl-2-hydroxy-2-phenyl-N-(4-piperidin-1-ylbut-2-ynyl)acetamide.
| Compound Name | 2-cyclohexyl-2-hydroxy-2-phenyl-N-(4-piperidin-1-ylbut-2-ynyl)acetamide |
|---|---|
| PubChem CID | 15023468 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-cyclohexyl-2-hydroxy-2-phenyl-N-(4-piperidin-1-ylbut-2-ynyl)acetamide |
| SMILES | O=C(NCC#CCN1CCCCC1)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C23H32N2O2/c26-22(24-16-8-11-19-25-17-9-3-10-18-25)23(27,20-12-4-1-5-13-20)21-14-6-2-7-15-21/h1,4-5,12-13,21,27H,2-3,6-7,9-10,14-19H2,(H,24,26) |
| InChIKey | HICKWZPEBLSYTI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|