C20H27NO2 — CID 15105857
1-cyclohexyl-1-hydroxy-7-(methylamino)-1-phenylhept-5-yn-2-one (PubChem CID 15105857) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-cyclohexyl-1-hydroxy-7-(methylamino)-1-phenylhept-5-yn-2-one.
| Compound Name | 1-cyclohexyl-1-hydroxy-7-(methylamino)-1-phenylhept-5-yn-2-one |
|---|---|
| PubChem CID | 15105857 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-cyclohexyl-1-hydroxy-7-(methylamino)-1-phenylhept-5-yn-2-one |
| SMILES | CNCC#CCCC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H27NO2/c1-21-16-10-4-9-15-19(22)20(23,17-11-5-2-6-12-17)18-13-7-3-8-14-18/h2,5-6,11-12,18,21,23H,3,7-9,13-16H2,1H3 |
| InChIKey | UBXLXXUCPJOIED-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|